C17H13ClN4O7 — CID 55554173
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 55554173) has the molecular formula C17H13ClN4O7 and a molecular weight of 420.77 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 55554173 |
| Molecular Formula | C17H13ClN4O7 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | O=C(COC(=O)CCc1nc(-c2ccco2)no1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H13ClN4O7/c18-11-8-10(22(25)26)3-4-12(11)19-14(23)9-28-16(24)6-5-15-20-17(21-29-15)13-2-1-7-27-13/h1-4,7-8H,5-6,9H2,(H,19,23) |
| InChIKey | BZBJJFBVAHHWPB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|