C18H14ClN5O6 — CID 46428179
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 46428179) has the molecular formula C18H14ClN5O6 and a molecular weight of 431.79 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 46428179 |
| Molecular Formula | C18H14ClN5O6 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc(-c2ccccn2)no1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClN5O6/c19-12-5-4-11(9-14(12)24(27)28)21-15(25)10-29-17(26)7-6-16-22-18(23-30-16)13-3-1-2-8-20-13/h1-5,8-9H,6-7,10H2,(H,21,25) |
| InChIKey | CFZSZWKBVBIFRL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|