C17H12Cl3N3O4S — CID 31656544
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 31656544) has the molecular formula C17H12Cl3N3O4S and a molecular weight of 460.73 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 31656544 |
| Molecular Formula | C17H12Cl3N3O4S |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc(-c2cccs2)no1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3N3O4S/c18-9-6-11(20)12(7-10(9)19)21-14(24)8-26-16(25)4-3-15-22-17(23-27-15)13-2-1-5-28-13/h1-2,5-7H,3-4,8H2,(H,21,24) |
| InChIKey | BGJVQVNNUWVHGL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|