C15H17ClN2O4S — CID 46639453
[2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 46639453) has the molecular formula C15H17ClN2O4S and a molecular weight of 356.83 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 46639453 |
| Molecular Formula | C15H17ClN2O4S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C15H17ClN2O4S/c1-10-11(16)3-2-4-12(10)17-13(19)9-22-14(20)5-6-18-7-8-23-15(18)21/h2-4H,5-9H2,1H3,(H,17,19) |
| InChIKey | JLBDEIHYKOHSCK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|