C15H15Cl3N4O3 — CID 7633792
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 7633792) has the molecular formula C15H15Cl3N4O3 and a molecular weight of 405.67 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7633792 |
| Molecular Formula | C15H15Cl3N4O3 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | N#CC1(NC(=O)COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)CCCCC1 |
| InChI | InChI=1S/C15H15Cl3N4O3/c16-9-11(20)10(17)13(18)21-12(9)14(24)25-6-8(23)22-15(7-19)4-2-1-3-5-15/h1-6H2,(H2,20,21)(H,22,23) |
| InChIKey | OKSPEZXYTXKBPF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|