C16H24N2O2 — CID 771759
3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(3-methylphenyl)propanamide (PubChem CID 771759) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(3-methylphenyl)propanamide.
| Compound Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 771759 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCN2C[C@@H](C)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-12-5-4-6-15(9-12)17-16(19)7-8-18-10-13(2)20-14(3)11-18/h4-6,9,13-14H,7-8,10-11H2,1-3H3,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | RWLAAXSFFQAGPX-ZIAGYGMSSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |