C29H24IN3O8 — CID 126056191
methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126056191) has the molecular formula C29H24IN3O8 and a molecular weight of 669.43 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126056191 |
| Molecular Formula | C29H24IN3O8 |
| Molecular Weight | 669.43 g/mol |
| Exact Mass | 669.06 |
| IUPAC Name | methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C\c3cc(I)c(OCC(=O)Nc4cccc(C)c4)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H24IN3O8/c1-16-5-4-6-19(11-16)31-24(34)15-41-25-22(30)13-17(14-23(25)39-2)12-21-26(35)32-29(38)33(27(21)36)20-9-7-18(8-10-20)28(37)40-3/h4-14H,15H2,1-3H3,(H,31,34)(H,32,35,38)/b21-12+ |
| InChIKey | YOGHBPUNNXPLRR-CIAFOILYSA-N |
| XLogP | 4.08 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|