C30H27Br2N3O7 — CID 126263293
2-[2,6-dibromo-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126263293) has the molecular formula C30H27Br2N3O7 and a molecular weight of 701.37 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126263293 |
| Molecular Formula | C30H27Br2N3O7 |
| Molecular Weight | 701.37 g/mol |
| Exact Mass | 699.02 |
| IUPAC Name | 2-[2,6-dibromo-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C/c3cc(Br)c(OCC(=O)Nc4cccc(C)c4)c(Br)c3)C2=O)cc1OC |
| InChI | InChI=1S/C30H27Br2N3O7/c1-4-10-41-24-9-8-20(15-25(24)40-3)35-29(38)21(28(37)34-30(35)39)12-18-13-22(31)27(23(32)14-18)42-16-26(36)33-19-7-5-6-17(2)11-19/h5-9,11-15H,4,10,16H2,1-3H3,(H,33,36)(H,34,37,39)/b21-12- |
| InChIKey | QSRCFPWQSARWSL-MTJSOVHGSA-N |
| XLogP | 6.00 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|