C30H28IN3O8 — CID 126279312
2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126279312) has the molecular formula C30H28IN3O8 and a molecular weight of 685.47 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126279312 |
| Molecular Formula | C30H28IN3O8 |
| Molecular Weight | 685.47 g/mol |
| Exact Mass | 685.09 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(Z)-[1-(3-methoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C/c3cc(I)c(OCC(=O)Nc4ccccc4)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C30H28IN3O8/c1-4-12-41-23-11-10-20(16-24(23)39-2)34-29(37)21(28(36)33-30(34)38)13-18-14-22(31)27(25(15-18)40-3)42-17-26(35)32-19-8-6-5-7-9-19/h5-11,13-16H,4,12,17H2,1-3H3,(H,32,35)(H,33,36,38)/b21-13- |
| InChIKey | VVSJFHONYBISNB-BKUYFWCQSA-N |
| XLogP | 4.78 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|