C23H20IN3O8 — CID 126231922
methyl 4-[(5E)-5-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126231922) has the molecular formula C23H20IN3O8 and a molecular weight of 593.33 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126231922 |
| Molecular Formula | C23H20IN3O8 |
| Molecular Weight | 593.33 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | methyl 4-[(5E)-5-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C(=O)OC)cc3)C2=O)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C23H20IN3O8/c1-3-34-17-10-12(9-16(24)19(17)35-11-18(25)28)8-15-20(29)26-23(32)27(21(15)30)14-6-4-13(5-7-14)22(31)33-2/h4-10H,3,11H2,1-2H3,(H2,25,28)(H,26,29,32)/b15-8+ |
| InChIKey | OJTKZCAQMUWDHO-OVCLIPMQSA-N |
| XLogP | 2.01 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|