C27H21ClIN3O6 — CID 126053540
2-[4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126053540) has the molecular formula C27H21ClIN3O6 and a molecular weight of 645.84 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126053540 |
| Molecular Formula | C27H21ClIN3O6 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.02 |
| IUPAC Name | 2-[4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccccc3Cl)C2=O)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C27H21ClIN3O6/c1-15-6-5-7-17(10-15)30-23(33)14-38-24-20(29)12-16(13-22(24)37-2)11-18-25(34)31-27(36)32(26(18)35)21-9-4-3-8-19(21)28/h3-13H,14H2,1-2H3,(H,30,33)(H,31,34,36)/b18-11+ |
| InChIKey | NGEYDGZGZUDXSM-WOJGMQOQSA-N |
| XLogP | 4.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|