C21H18BrFINO2 — CID 126211950
4-bromo-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline (PubChem CID 126211950) has the molecular formula C21H18BrFINO2 and a molecular weight of 542.19 g/mol. Its IUPAC name is 4-bromo-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline.
| Compound Name | 4-bromo-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 126211950 |
| Molecular Formula | C21H18BrFINO2 |
| Molecular Weight | 542.19 g/mol |
| Exact Mass | 540.95 |
| IUPAC Name | 4-bromo-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccc(Br)cc2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H18BrFINO2/c1-26-20-11-14(12-25-17-8-6-16(22)7-9-17)10-19(24)21(20)27-13-15-4-2-3-5-18(15)23/h2-11,25H,12-13H2,1H3 |
| InChIKey | JSKSTVRKTJHVHK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.19 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|