C16H17ClINO2 — CID 126184824
2-chloro-N-[(4-ethoxy-3-iodo-5-methoxyphenyl)methyl]aniline (PubChem CID 126184824) has the molecular formula C16H17ClINO2 and a molecular weight of 417.67 g/mol. Its IUPAC name is 2-chloro-N-[(4-ethoxy-3-iodo-5-methoxyphenyl)methyl]aniline.
| Compound Name | 2-chloro-N-[(4-ethoxy-3-iodo-5-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 126184824 |
| Molecular Formula | C16H17ClINO2 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-chloro-N-[(4-ethoxy-3-iodo-5-methoxyphenyl)methyl]aniline |
| SMILES | CCOc1c(I)cc(CNc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C16H17ClINO2/c1-3-21-16-13(18)8-11(9-15(16)20-2)10-19-14-7-5-4-6-12(14)17/h4-9,19H,3,10H2,1-2H3 |
| InChIKey | LAZCVHLZASVWSP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|