C17H15Br2NO2 — CID 126118933
N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-4-methoxyaniline (PubChem CID 126118933) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-4-methoxyaniline.
| Compound Name | N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 126118933 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | N-[(3,5-dibromo-4-prop-2-ynoxyphenyl)methyl]-4-methoxyaniline |
| SMILES | C#CCOc1c(Br)cc(CNc2ccc(OC)cc2)cc1Br |
| InChI | InChI=1S/C17H15Br2NO2/c1-3-8-22-17-15(18)9-12(10-16(17)19)11-20-13-4-6-14(21-2)7-5-13/h1,4-7,9-10,20H,8,11H2,2H3 |
| InChIKey | FEPFVIZHZKLEBZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|