C17H16BrNO2 — CID 126124848
N-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]aniline (PubChem CID 126124848) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]aniline.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 126124848 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methyl]aniline |
| SMILES | C#CCOc1c(Br)cc(CNc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H16BrNO2/c1-3-9-21-17-15(18)10-13(11-16(17)20-2)12-19-14-7-5-4-6-8-14/h1,4-8,10-11,19H,9,12H2,2H3 |
| InChIKey | NYCOIXVVXYBBBT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|