C18H18ClNO2 — CID 126121825
N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline (PubChem CID 126121825) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline.
| Compound Name | N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126121825 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
| SMILES | C#CCOc1c(Cl)cc(CNc2ccccc2C)cc1OC |
| InChI | InChI=1S/C18H18ClNO2/c1-4-9-22-18-15(19)10-14(11-17(18)21-3)12-20-16-8-6-5-7-13(16)2/h1,5-8,10-11,20H,9,12H2,2-3H3 |
| InChIKey | RXBFPVLRQPSWNF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|