C18H17Cl2NO2 — CID 126116588
5-chloro-N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline (PubChem CID 126116588) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is 5-chloro-N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline.
| Compound Name | 5-chloro-N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126116588 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-chloro-N-[(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
| SMILES | C#CCOc1c(Cl)cc(CNc2cc(Cl)ccc2C)cc1OC |
| InChI | InChI=1S/C18H17Cl2NO2/c1-4-7-23-18-15(20)8-13(9-17(18)22-3)11-21-16-10-14(19)6-5-12(16)2/h1,5-6,8-10,21H,7,11H2,2-3H3 |
| InChIKey | ANSIGOWUUZIDDZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|