C17H15Cl2NO — CID 126123859
5-chloro-N-[(5-chloro-2-prop-2-ynoxyphenyl)methyl]-2-methylaniline (PubChem CID 126123859) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 5-chloro-N-[(5-chloro-2-prop-2-ynoxyphenyl)methyl]-2-methylaniline.
| Compound Name | 5-chloro-N-[(5-chloro-2-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126123859 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 5-chloro-N-[(5-chloro-2-prop-2-ynoxyphenyl)methyl]-2-methylaniline |
| SMILES | C#CCOc1ccc(Cl)cc1CNc1cc(Cl)ccc1C |
| InChI | InChI=1S/C17H15Cl2NO/c1-3-8-21-17-7-6-14(18)9-13(17)11-20-16-10-15(19)5-4-12(16)2/h1,4-7,9-10,20H,8,11H2,2H3 |
| InChIKey | OJLYVDXXGDTPGU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|