C18H20ClNO — CID 126116679
N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-2,5-dimethylaniline (PubChem CID 126116679) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-2,5-dimethylaniline.
| Compound Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 126116679 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-2,5-dimethylaniline |
| SMILES | C=CCOc1ccc(Cl)cc1CNc1cc(C)ccc1C |
| InChI | InChI=1S/C18H20ClNO/c1-4-9-21-18-8-7-16(19)11-15(18)12-20-17-10-13(2)5-6-14(17)3/h4-8,10-11,20H,1,9,12H2,2-3H3 |
| InChIKey | VBTXWGVTBNAFPD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|