C12H13ClN4O — CID 7935027
N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine (PubChem CID 7935027) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 7935027 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine |
| SMILES | C=CCOc1ccc(Cl)cc1CNc1ncn[nH]1 |
| InChI | InChI=1S/C12H13ClN4O/c1-2-5-18-11-4-3-10(13)6-9(11)7-14-12-15-8-16-17-12/h2-4,6,8H,1,5,7H2,(H2,14,15,16,17) |
| InChIKey | LWXLJFVPMGQDMO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|