C11H13ClN4O — CID 6492066
N-[(5-chloro-2-ethoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine (PubChem CID 6492066) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is N-[(5-chloro-2-ethoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[(5-chloro-2-ethoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 6492066 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N-[(5-chloro-2-ethoxyphenyl)methyl]-1H-1,2,4-triazol-5-amine |
| SMILES | CCOc1ccc(Cl)cc1CNc1ncn[nH]1 |
| InChI | InChI=1S/C11H13ClN4O/c1-2-17-10-4-3-9(12)5-8(10)6-13-11-14-7-15-16-11/h3-5,7H,2,6H2,1H3,(H2,13,14,15,16) |
| InChIKey | PLELUIQIVXYSLK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |