C19H24ClNO2 — CID 126120424
N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-methylaniline (PubChem CID 126120424) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-methylaniline.
| Compound Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126120424 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(3-chloro-5-ethoxy-4-propoxyphenyl)methyl]-2-methylaniline |
| SMILES | CCCOc1c(Cl)cc(CNc2ccccc2C)cc1OCC |
| InChI | InChI=1S/C19H24ClNO2/c1-4-10-23-19-16(20)11-15(12-18(19)22-5-2)13-21-17-9-7-6-8-14(17)3/h6-9,11-12,21H,4-5,10,13H2,1-3H3 |
| InChIKey | CFPFTYQJRGARFU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |