C31H34Cl3N7O — CID 146050795
2-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,3-dimethylphenyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 146050795) has the molecular formula C31H34Cl3N7O and a molecular weight of 627.02 g/mol. Its IUPAC name is 2-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,3-dimethylphenyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,3-dimethylphenyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 146050795 |
| Molecular Formula | C31H34Cl3N7O |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 2-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,3-dimethylphenyl)-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1cccc(Nc2nc(N/N=C/c3ccc(OCc4ccc(Cl)cc4Cl)cc3)nc(N3CCC(C)CC3)n2)c1C.Cl |
| InChI | InChI=1S/C31H33Cl2N7O.ClH/c1-20-13-15-40(16-14-20)31-37-29(35-28-6-4-5-21(2)22(28)3)36-30(38-31)39-34-18-23-7-11-26(12-8-23)41-19-24-9-10-25(32)17-27(24)33;/h4-12,17-18,20H,13-16,19H2,1-3H3,(H2,35,36,37,38,39);1H/b34-18+; |
| InChIKey | YFCSPFJGXTWLHJ-YRRVWJCVSA-N |
| XLogP | 8.22 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|