C24H29ClFN7 — CID 90484566
4-N-(2,3-dimethylphenyl)-2-N-[(E)-(4-fluorophenyl)methylideneamino]-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 90484566) has the molecular formula C24H29ClFN7 and a molecular weight of 470.00 g/mol. Its IUPAC name is 4-N-(2,3-dimethylphenyl)-2-N-[(E)-(4-fluorophenyl)methylideneamino]-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-(2,3-dimethylphenyl)-2-N-[(E)-(4-fluorophenyl)methylideneamino]-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90484566 |
| Molecular Formula | C24H29ClFN7 |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-N-(2,3-dimethylphenyl)-2-N-[(E)-(4-fluorophenyl)methylideneamino]-6-(4-methylpiperidin-1-yl)-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1cccc(Nc2nc(N/N=C/c3ccc(F)cc3)nc(N3CCC(C)CC3)n2)c1C.Cl |
| InChI | InChI=1S/C24H28FN7.ClH/c1-16-11-13-32(14-12-16)24-29-22(27-21-6-4-5-17(2)18(21)3)28-23(30-24)31-26-15-19-7-9-20(25)10-8-19;/h4-10,15-16H,11-14H2,1-3H3,(H2,27,28,29,30,31);1H/b26-15+; |
| InChIKey | VVCNLJRAYWACSG-UUXIZDQESA-N |
| XLogP | 5.48 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|