C24H26N8 — CID 172920458
2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperazin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 172920458) has the molecular formula C24H26N8 and a molecular weight of 426.53 g/mol. Its IUPAC name is 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperazin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperazin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 172920458 |
| Molecular Formula | C24H26N8 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-N-[(E)-3H-inden-1-ylmethylideneamino]-4-N-(4-methylphenyl)-6-piperazin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C/C3=CCc4ccccc43)nc(N3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C24H26N8/c1-17-6-10-20(11-7-17)27-22-28-23(30-24(29-22)32-14-12-25-13-15-32)31-26-16-19-9-8-18-4-2-3-5-21(18)19/h2-7,9-11,16,25H,8,12-15H2,1H3,(H2,27,28,29,30,31)/b26-16+ |
| InChIKey | XWRYDTVEYUCIPW-WGOQTCKBSA-N |
| XLogP | 3.37 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|