C17H13ClN3O4- — CID 8973943
4-chloro-3-[(2Z)-2-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]benzoate (PubChem CID 8973943) has the molecular formula C17H13ClN3O4- and a molecular weight of 358.76 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2Z)-2-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8973943 |
| Molecular Formula | C17H13ClN3O4- |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[[4-(cyanomethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]benzoate |
| SMILES | COc1cc(/C=N\Nc2cc(C(=O)[O-])ccc2Cl)ccc1OCC#N |
| InChI | InChI=1S/C17H14ClN3O4/c1-24-16-8-11(2-5-15(16)25-7-6-19)10-20-21-14-9-12(17(22)23)3-4-13(14)18/h2-5,8-10,21H,7H2,1H3,(H,22,23)/p-1/b20-10- |
| InChIKey | NXDZAWHEAOJQAJ-JMIUGGIZSA-M |
| XLogP | 2.06 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|