C17H14IN3O4 — CID 6153602
N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-hydroxy-4-iodobenzamide (PubChem CID 6153602) has the molecular formula C17H14IN3O4 and a molecular weight of 451.22 g/mol. Its IUPAC name is N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-hydroxy-4-iodobenzamide.
| Compound Name | N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 6153602 |
| Molecular Formula | C17H14IN3O4 |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | N-[(Z)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-hydroxy-4-iodobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(I)c(O)c2)ccc1OCC#N |
| InChI | InChI=1S/C17H14IN3O4/c1-24-16-8-11(2-5-15(16)25-7-6-19)10-20-21-17(23)12-3-4-13(18)14(22)9-12/h2-5,8-10,22H,7H2,1H3,(H,21,23)/b20-10- |
| InChIKey | IYPKKZQBTYTYTG-JMIUGGIZSA-N |
| XLogP | 2.67 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|