C19H19IN2O6 — CID 126022726
(2S)-2-[4-[(E)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126022726) has the molecular formula C19H19IN2O6 and a molecular weight of 498.27 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(E)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126022726 |
| Molecular Formula | C19H19IN2O6 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | (2S)-2-[4-[(E)-[(4-iodo-3-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(C(=O)N/N=C/c2ccc(O[C@@H](C)C(=O)O)c(OC)c2)ccc1I |
| InChI | InChI=1S/C19H19IN2O6/c1-11(19(24)25)28-15-7-4-12(8-17(15)27-3)10-21-22-18(23)13-5-6-14(20)16(9-13)26-2/h4-11H,1-3H3,(H,22,23)(H,24,25)/b21-10+/t11-/m0/s1 |
| InChIKey | SKQWZDRPVCWIDC-JYQBEENSSA-N |
| XLogP | 2.92 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|