C20H23N3O5 — CID 126023268
(2S)-2-[4-[(E)-[(3,4-dimethylphenyl)carbamoylhydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 126023268) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-[(3,4-dimethylphenyl)carbamoylhydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[(E)-[(3,4-dimethylphenyl)carbamoylhydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126023268 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S)-2-[4-[(E)-[(3,4-dimethylphenyl)carbamoylhydrazinylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=N/NC(=O)Nc2ccc(C)c(C)c2)ccc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H23N3O5/c1-12-5-7-16(9-13(12)2)22-20(26)23-21-11-15-6-8-17(18(10-15)27-4)28-14(3)19(24)25/h5-11,14H,1-4H3,(H,24,25)(H2,22,23,26)/b21-11+/t14-/m0/s1 |
| InChIKey | VKEJNOQDCXNRNW-FVUPAENESA-N |
| XLogP | 3.32 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|