C21H23N3O5 — CID 46804638
N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide (PubChem CID 46804638) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide.
| Compound Name | N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 46804638 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(E)-[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]-3-methoxy-4-propan-2-yloxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(OC(C)C)c(OC)c2)ccc1OCC#N |
| InChI | InChI=1S/C21H23N3O5/c1-14(2)29-18-8-6-16(12-20(18)27-4)21(25)24-23-13-15-5-7-17(28-10-9-22)19(11-15)26-3/h5-8,11-14H,10H2,1-4H3,(H,24,25)/b23-13+ |
| InChIKey | SJAGUXYPEGVKQT-YDZHTSKRSA-N |
| XLogP | 3.16 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|