C18H16BrN3O4 — CID 3996217
2-(4-bromophenoxy)-N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 3996217) has the molecular formula C18H16BrN3O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3996217 |
| Molecular Formula | C18H16BrN3O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[4-(cyanomethoxy)-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)COc2ccc(Br)cc2)ccc1OCC#N |
| InChI | InChI=1S/C18H16BrN3O4/c1-24-17-10-13(2-7-16(17)25-9-8-20)11-21-22-18(23)12-26-15-5-3-14(19)4-6-15/h2-7,10-11H,9,12H2,1H3,(H,22,23) |
| InChIKey | TURPXCWMSHDUKV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|