C21H18F2N4O6S — CID 6279235
4-[(2Z)-2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 6279235) has the molecular formula C21H18F2N4O6S and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-[(2Z)-2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6279235 |
| Molecular Formula | C21H18F2N4O6S |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-[(2Z)-2-[[2-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(N/N=C\c2ccccc2OC(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18F2N4O6S/c1-32-20-9-5-3-7-17(20)26-34(30,31)15-10-11-16(18(12-15)27(28)29)25-24-13-14-6-2-4-8-19(14)33-21(22)23/h2-13,21,25-26H,1H3/b24-13- |
| InChIKey | YXNFEILBQVBZPO-CFRMEGHHSA-N |
| XLogP | 4.45 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|