C18H16ClF3N2O2 — CID 19579409
N-[(Z)-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 19579409) has the molecular formula C18H16ClF3N2O2 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 19579409 |
| Molecular Formula | C18H16ClF3N2O2 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[(Z)-(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | C=CCOc1c(Cl)cc(/C=N\Nc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C18H16ClF3N2O2/c1-3-7-26-17-15(19)8-12(9-16(17)25-2)11-23-24-14-6-4-5-13(10-14)18(20,21)22/h3-6,8-11,24H,1,7H2,2H3/b23-11- |
| InChIKey | VNEBNMZZGWKTRG-KSEXSDGBSA-N |
| XLogP | 5.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|