C18H20ClN5O3 — CID 168591939
2-[2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 168591939) has the molecular formula C18H20ClN5O3 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-[2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 168591939 |
| Molecular Formula | C18H20ClN5O3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[2-chloro-4-[(diaminomethylidenehydrazinylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=NN=C(N)N)cc(Cl)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H20ClN5O3/c1-2-26-15-9-12(10-22-24-18(20)21)8-14(19)17(15)27-11-16(25)23-13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H,23,25)(H4,20,21,24) |
| InChIKey | QPYJYXDPJBOWBJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|