C10H12F2N4O — CID 168590943
2-[(3-ethoxy-4,5-difluorophenyl)methylideneamino]guanidine (PubChem CID 168590943) has the molecular formula C10H12F2N4O and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(3-ethoxy-4,5-difluorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3-ethoxy-4,5-difluorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590943 |
| Molecular Formula | C10H12F2N4O |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(3-ethoxy-4,5-difluorophenyl)methylideneamino]guanidine |
| SMILES | CCOc1cc(C=NN=C(N)N)cc(F)c1F |
| InChI | InChI=1S/C10H12F2N4O/c1-2-17-8-4-6(3-7(11)9(8)12)5-15-16-10(13)14/h3-5H,2H2,1H3,(H4,13,14,16) |
| InChIKey | XAKJBALIHXZADM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|