C14H10ClI4NO2 — CID 89281691
4-[4-[2-(chloroamino)ethyl]-2,6-diiodophenoxy]-2,6-diiodophenol (PubChem CID 89281691) has the molecular formula C14H10ClI4NO2 and a molecular weight of 767.31 g/mol. Its IUPAC name is 4-[4-[2-(chloroamino)ethyl]-2,6-diiodophenoxy]-2,6-diiodophenol.
| Compound Name | 4-[4-[2-(chloroamino)ethyl]-2,6-diiodophenoxy]-2,6-diiodophenol |
|---|---|
| PubChem CID | 89281691 |
| Molecular Formula | C14H10ClI4NO2 |
| Molecular Weight | 767.31 g/mol |
| Exact Mass | 766.66 |
| IUPAC Name | 4-[4-[2-(chloroamino)ethyl]-2,6-diiodophenoxy]-2,6-diiodophenol |
| SMILES | Oc1c(I)cc(Oc2c(I)cc(CCNCl)cc2I)cc1I |
| InChI | InChI=1S/C14H10ClI4NO2/c15-20-2-1-7-3-11(18)14(12(19)4-7)22-8-5-9(16)13(21)10(17)6-8/h3-6,20-21H,1-2H2 |
| InChIKey | ROAUGJDSEKPGST-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|