C31H39NO3 — CID 67649388
N,N-di(propan-2-yl)-2,4-bis(2,4,6-trimethylphenoxy)benzamide (PubChem CID 67649388) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2,4-bis(2,4,6-trimethylphenoxy)benzamide.
| Compound Name | N,N-di(propan-2-yl)-2,4-bis(2,4,6-trimethylphenoxy)benzamide |
|---|---|
| PubChem CID | 67649388 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | N,N-di(propan-2-yl)-2,4-bis(2,4,6-trimethylphenoxy)benzamide |
| SMILES | Cc1cc(C)c(Oc2ccc(C(=O)N(C(C)C)C(C)C)c(Oc3c(C)cc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C31H39NO3/c1-18(2)32(19(3)4)31(33)27-12-11-26(34-29-22(7)13-20(5)14-23(29)8)17-28(27)35-30-24(9)15-21(6)16-25(30)10/h11-19H,1-10H3 |
| InChIKey | DKKGCWKPSMPSGI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |