C20H24BrNO — CID 102224018
2-bromo-5-(4-methylphenyl)-N,N-di(propan-2-yl)benzamide (PubChem CID 102224018) has the molecular formula C20H24BrNO and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-bromo-5-(4-methylphenyl)-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-bromo-5-(4-methylphenyl)-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 102224018 |
| Molecular Formula | C20H24BrNO |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-bromo-5-(4-methylphenyl)-N,N-di(propan-2-yl)benzamide |
| SMILES | Cc1ccc(-c2ccc(Br)c(C(=O)N(C(C)C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C20H24BrNO/c1-13(2)22(14(3)4)20(23)18-12-17(10-11-19(18)21)16-8-6-15(5)7-9-16/h6-14H,1-5H3 |
| InChIKey | RZEDTOIOJPIPGJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |