C13H17BrO — CID 130674056
1-(2-bromo-5-methylphenyl)-2,3-dimethylbutan-1-one (PubChem CID 130674056) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-2,3-dimethylbutan-1-one.
| Compound Name | 1-(2-bromo-5-methylphenyl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 130674056 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-2,3-dimethylbutan-1-one |
| SMILES | Cc1ccc(Br)c(C(=O)C(C)C(C)C)c1 |
| InChI | InChI=1S/C13H17BrO/c1-8(2)10(4)13(15)11-7-9(3)5-6-12(11)14/h5-8,10H,1-4H3 |
| InChIKey | YKQUOTLVHUVWMU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |