C23H26ClNO7S — CID 69258795
ethyl 3-[3-chloro-4-[3-(cyclobutylmethylsulfonyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoate (PubChem CID 69258795) has the molecular formula C23H26ClNO7S and a molecular weight of 495.98 g/mol. Its IUPAC name is ethyl 3-[3-chloro-4-[3-(cyclobutylmethylsulfonyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[3-chloro-4-[3-(cyclobutylmethylsulfonyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69258795 |
| Molecular Formula | C23H26ClNO7S |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | ethyl 3-[3-chloro-4-[3-(cyclobutylmethylsulfonyl)-2-hydroxyphenoxy]-5-methylanilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(C)c(Oc2cccc(S(=O)(=O)CC3CCC3)c2O)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClNO7S/c1-3-31-21(27)12-20(26)25-16-10-14(2)23(17(24)11-16)32-18-8-5-9-19(22(18)28)33(29,30)13-15-6-4-7-15/h5,8-11,15,28H,3-4,6-7,12-13H2,1-2H3,(H,25,26) |
| InChIKey | PTAUAWDIKAFASR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|