C11H11BrClNO3 — CID 134123354
ethyl 3-(4-bromo-3-chloroanilino)-3-oxopropanoate (PubChem CID 134123354) has the molecular formula C11H11BrClNO3 and a molecular weight of 320.57 g/mol. Its IUPAC name is ethyl 3-(4-bromo-3-chloroanilino)-3-oxopropanoate.
| Compound Name | ethyl 3-(4-bromo-3-chloroanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 134123354 |
| Molecular Formula | C11H11BrClNO3 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | ethyl 3-(4-bromo-3-chloroanilino)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C11H11BrClNO3/c1-2-17-11(16)6-10(15)14-7-3-4-8(12)9(13)5-7/h3-5H,2,6H2,1H3,(H,14,15) |
| InChIKey | CISSEQIZUDRNHG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|