C22H18Cl2N2O4 — CID 127051934
3-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide (PubChem CID 127051934) has the molecular formula C22H18Cl2N2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 3-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 127051934 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 3-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide |
| SMILES | CCC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(-c3cccc(C(N)=O)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-2-20(28)26-14-9-17(23)21(18(24)10-14)30-15-6-7-19(27)16(11-15)12-4-3-5-13(8-12)22(25)29/h3-11,27H,2H2,1H3,(H2,25,29)(H,26,28) |
| InChIKey | HOVXGCGAAGTKQF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |