C16H18BrNO — CID 107726956
2-[4-(4-bromo-3,5-dimethylphenoxy)phenyl]ethanamine (PubChem CID 107726956) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is 2-[4-(4-bromo-3,5-dimethylphenoxy)phenyl]ethanamine.
| Compound Name | 2-[4-(4-bromo-3,5-dimethylphenoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107726956 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[4-(4-bromo-3,5-dimethylphenoxy)phenyl]ethanamine |
| SMILES | Cc1cc(Oc2ccc(CCN)cc2)cc(C)c1Br |
| InChI | InChI=1S/C16H18BrNO/c1-11-9-15(10-12(2)16(11)17)19-14-5-3-13(4-6-14)7-8-18/h3-6,9-10H,7-8,18H2,1-2H3 |
| InChIKey | PZRCBRCAMBRRRU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |