C14H14ClI2NO2 — CID 11497243
4-[4-(2-aminoethyl)phenoxy]-2,6-diiodophenol;hydrochloride (PubChem CID 11497243) has the molecular formula C14H14ClI2NO2 and a molecular weight of 517.53 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)phenoxy]-2,6-diiodophenol;hydrochloride.
| Compound Name | 4-[4-(2-aminoethyl)phenoxy]-2,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 11497243 |
| Molecular Formula | C14H14ClI2NO2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 516.88 |
| IUPAC Name | 4-[4-(2-aminoethyl)phenoxy]-2,6-diiodophenol;hydrochloride |
| SMILES | Cl.NCCc1ccc(Oc2cc(I)c(O)c(I)c2)cc1 |
| InChI | InChI=1S/C14H13I2NO2.ClH/c15-12-7-11(8-13(16)14(12)18)19-10-3-1-9(2-4-10)5-6-17;/h1-4,7-8,18H,5-6,17H2;1H |
| InChIKey | FYWAYVJYUCRMJH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|