C13H11I2NO2 — CID 155040115
4-[4-(aminomethyl)phenoxy]-2,6-diiodophenol (PubChem CID 155040115) has the molecular formula C13H11I2NO2 and a molecular weight of 467.04 g/mol. Its IUPAC name is 4-[4-(aminomethyl)phenoxy]-2,6-diiodophenol.
| Compound Name | 4-[4-(aminomethyl)phenoxy]-2,6-diiodophenol |
|---|---|
| PubChem CID | 155040115 |
| Molecular Formula | C13H11I2NO2 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 466.89 |
| IUPAC Name | 4-[4-(aminomethyl)phenoxy]-2,6-diiodophenol |
| SMILES | NCc1ccc(Oc2cc(I)c(O)c(I)c2)cc1 |
| InChI | InChI=1S/C13H11I2NO2/c14-11-5-10(6-12(15)13(11)17)18-9-3-1-8(7-16)2-4-9/h1-6,17H,7,16H2 |
| InChIKey | UENQVIFAQJOUPM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|