C14H20Br2O4S — CID 104521513
1-bromo-2-(1-bromo-2-methylsulfonylpropyl)-4,5-diethoxybenzene (PubChem CID 104521513) has the molecular formula C14H20Br2O4S and a molecular weight of 444.19 g/mol. Its IUPAC name is 1-bromo-2-(1-bromo-2-methylsulfonylpropyl)-4,5-diethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromo-2-methylsulfonylpropyl)-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 104521513 |
| Molecular Formula | C14H20Br2O4S |
| Molecular Weight | 444.19 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | 1-bromo-2-(1-bromo-2-methylsulfonylpropyl)-4,5-diethoxybenzene |
| SMILES | CCOc1cc(Br)c(C(Br)C(C)S(C)(=O)=O)cc1OCC |
| InChI | InChI=1S/C14H20Br2O4S/c1-5-19-12-7-10(11(15)8-13(12)20-6-2)14(16)9(3)21(4,17)18/h7-9,14H,5-6H2,1-4H3 |
| InChIKey | YEGYOBVHZRTHEU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|