C17H20Br2O — CID 70799714
1,5-dibromo-2-hexoxy-6-methylnaphthalene (PubChem CID 70799714) has the molecular formula C17H20Br2O and a molecular weight of 400.15 g/mol. Its IUPAC name is 1,5-dibromo-2-hexoxy-6-methylnaphthalene.
| Compound Name | 1,5-dibromo-2-hexoxy-6-methylnaphthalene |
|---|---|
| PubChem CID | 70799714 |
| Molecular Formula | C17H20Br2O |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 1,5-dibromo-2-hexoxy-6-methylnaphthalene |
| SMILES | CCCCCCOc1ccc2c(Br)c(C)ccc2c1Br |
| InChI | InChI=1S/C17H20Br2O/c1-3-4-5-6-11-20-15-10-9-13-14(17(15)19)8-7-12(2)16(13)18/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | KXWPKMLECZSZSR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|