C10H11BrCl2O2 — CID 163990086
1-bromo-2,3-dichloro-5-(2-ethoxyethoxy)benzene (PubChem CID 163990086) has the molecular formula C10H11BrCl2O2 and a molecular weight of 314.01 g/mol. Its IUPAC name is 1-bromo-2,3-dichloro-5-(2-ethoxyethoxy)benzene.
| Compound Name | 1-bromo-2,3-dichloro-5-(2-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 163990086 |
| Molecular Formula | C10H11BrCl2O2 |
| Molecular Weight | 314.01 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 1-bromo-2,3-dichloro-5-(2-ethoxyethoxy)benzene |
| SMILES | CCOCCOc1cc(Cl)c(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H11BrCl2O2/c1-2-14-3-4-15-7-5-8(11)10(13)9(12)6-7/h5-6H,2-4H2,1H3 |
| InChIKey | TZVJTXREHOZHLU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|