C13H18Br3NO4 — CID 21411252
1-[bis(2-hydroxyethyl)amino]-3-(3,4,5-tribromophenoxy)propan-2-ol (PubChem CID 21411252) has the molecular formula C13H18Br3NO4 and a molecular weight of 492.00 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-(3,4,5-tribromophenoxy)propan-2-ol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-(3,4,5-tribromophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 21411252 |
| Molecular Formula | C13H18Br3NO4 |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 488.88 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-(3,4,5-tribromophenoxy)propan-2-ol |
| SMILES | OCCN(CCO)CC(O)COc1cc(Br)c(Br)c(Br)c1 |
| InChI | InChI=1S/C13H18Br3NO4/c14-11-5-10(6-12(15)13(11)16)21-8-9(20)7-17(1-3-18)2-4-19/h5-6,9,18-20H,1-4,7-8H2 |
| InChIKey | PVURCEWJFKBQAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|