C9H11BrN2O3 — CID 107278941
2-bromo-N'-hydroxy-4-(2-hydroxyethoxy)benzenecarboximidamide (PubChem CID 107278941) has the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-4-(2-hydroxyethoxy)benzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-4-(2-hydroxyethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 107278941 |
| Molecular Formula | C9H11BrN2O3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-bromo-N'-hydroxy-4-(2-hydroxyethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(OCCO)cc1Br |
| InChI | InChI=1S/C9H11BrN2O3/c10-8-5-6(15-4-3-13)1-2-7(8)9(11)12-14/h1-2,5,13-14H,3-4H2,(H2,11,12) |
| InChIKey | XIPJNDMZIPUBBS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|